C19H22BrNS — CID 54587671
(6S,10bS)-6-(4-methylsulfanylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;hydrobromide (PubChem CID 54587671) has the molecular formula C19H22BrNS and a molecular weight of 376.36 g/mol. Its IUPAC name is (6S,10bS)-6-(4-methylsulfanylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;hydrobromide.
| Compound Name | (6S,10bS)-6-(4-methylsulfanylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;hydrobromide |
|---|---|
| PubChem CID | 54587671 |
| Molecular Formula | C19H22BrNS |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | (6S,10bS)-6-(4-methylsulfanylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;hydrobromide |
| SMILES | Br.CSc1ccc([C@@H]2CN3CCC[C@H]3c3ccccc32)cc1 |
| InChI | InChI=1S/C19H21NS.BrH/c1-21-15-10-8-14(9-11-15)18-13-20-12-4-7-19(20)17-6-3-2-5-16(17)18;/h2-3,5-6,8-11,18-19H,4,7,12-13H2,1H3;1H/t18-,19-;/m0./s1 |
| InChIKey | GPESYRGZLYHCAN-HLRBRJAUSA-N |
| XLogP | 5.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |