C18H20ClN3 — CID 54587721
2-(2-pyridin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride (PubChem CID 54587721) has the molecular formula C18H20ClN3 and a molecular weight of 313.83 g/mol. Its IUPAC name is 2-(2-pyridin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride.
| Compound Name | 2-(2-pyridin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride |
|---|---|
| PubChem CID | 54587721 |
| Molecular Formula | C18H20ClN3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-(2-pyridin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride |
| SMILES | Cl.c1ccc(CCN2CCc3[nH]c4ccccc4c3C2)nc1 |
| InChI | InChI=1S/C18H19N3.ClH/c1-2-7-17-15(6-1)16-13-21(12-9-18(16)20-17)11-8-14-5-3-4-10-19-14;/h1-7,10,20H,8-9,11-13H2;1H |
| InChIKey | WMNPFSVEYCGCQE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|