C21H36O11 — CID 54587751
(2S,3S,4R,5R,6S)-2-[[(4R)-4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]methoxy]-6-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol (PubChem CID 54587751) has the molecular formula C21H36O11 and a molecular weight of 464.51 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-[[(4R)-4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]methoxy]-6-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6S)-2-[[(4R)-4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]methoxy]-6-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 54587751 |
| Molecular Formula | C21H36O11 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-[[(4R)-4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]methoxy]-6-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
| SMILES | CC(C)(O)[C@H]1CC=C(CO[C@H]2O[C@@H](CO[C@H]3OC[C@H](O)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)CC1 |
| InChI | InChI=1S/C21H36O11/c1-21(2,28)11-5-3-10(4-6-11)7-29-20-18(27)16(25)15(24)13(32-20)9-31-19-17(26)14(23)12(22)8-30-19/h3,11-20,22-28H,4-9H2,1-2H3/t11-,12-,13-,14+,15-,16+,17-,18-,19+,20-/m0/s1 |
| InChIKey | MQXZFEFINCOMLT-SVOIQLESSA-N |
| XLogP | -2.24 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|