About 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid
2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid (PubChem CID 54588222) has the molecular formula C19H37BN2O4
and a molecular weight of 368.33 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid.
Molecular Properties
| Compound Name | 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid |
| PubChem CID | 54588222 |
| Molecular Formula | C19H37BN2O4 |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid |
| SMILES | CC1(C)CCC(N2CCC(C(N)(CCCCB(O)O)C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C19H37BN2O4/c1-18(2)10-5-16(6-11-18)22-13-7-15(8-14-22)19(21,17(23)24)9-3-4-12-20(25)26/h15-16,25-26H,3-14,21H2,1-2H3,(H,23,24) |
| InChIKey | FQADXABWZJKTHB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid?
The IUPAC name of 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid (CID 54588222) is 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid.
What is the SMILES notation for 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid?
The canonical SMILES for 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid is CC1(C)CCC(N2CCC(C(N)(CCCCB(O)O)C(=O)O)CC2)CC1.
What is the InChIKey of 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid?
The InChIKey is FQADXABWZJKTHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37BN2O4/c1-18(2)10-5-16(6-11-18)22-13-7-15(8-14-22)19(21,17(23)24)9-3-4-12-20(25)26/h15-16,25-26H,3-14,21H2,1-2H3,(H,23,24).
What are the key properties of 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid?
2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid has a molecular weight of 368.33 g/mol, XLogP of 2.09, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-borono-2-[1-(4,4-dimethylcyclohexyl)piperidin-4-yl]hexanoic acid is sourced from PubChem (CID 54588222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).