C30H18O9 — CID 5458849
8-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-1-yl)-1,4,5-trihydroxy-2-methylanthracene-9,10-dione (PubChem CID 5458849) has the molecular formula C30H18O9 and a molecular weight of 522.47 g/mol. Its IUPAC name is 8-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-1-yl)-1,4,5-trihydroxy-2-methylanthracene-9,10-dione.
| Compound Name | 8-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-1-yl)-1,4,5-trihydroxy-2-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 5458849 |
| Molecular Formula | C30H18O9 |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 8-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-1-yl)-1,4,5-trihydroxy-2-methylanthracene-9,10-dione |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1c(-c3ccc(O)c4c3C(=O)c3c(O)c(C)cc(O)c3C4=O)ccc(O)c1C2=O |
| InChI | InChI=1S/C30H18O9/c1-10-7-14-19(17(33)8-10)28(37)22-15(31)5-3-12(20(22)27(14)36)13-4-6-16(32)23-21(13)29(38)25-24(30(23)39)18(34)9-11(2)26(25)35/h3-9,31-35H,1-2H3 |
| InChIKey | PULGOKPDLMTOBV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|