About 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one
3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one (PubChem CID 54588508) has the molecular formula C15H13NO4
and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one |
| PubChem CID | 54588508 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one |
| SMILES | Cc1ccc2oc(=O)n(Cc3cc(O)ccc3O)c2c1 |
| InChI | InChI=1S/C15H13NO4/c1-9-2-5-14-12(6-9)16(15(19)20-14)8-10-7-11(17)3-4-13(10)18/h2-7,17-18H,8H2,1H3 |
| InChIKey | CYXIMPARGITFQN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one?
The IUPAC name of 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one (CID 54588508) is 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one?
The canonical SMILES for 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one is Cc1ccc2oc(=O)n(Cc3cc(O)ccc3O)c2c1.
What is the InChIKey of 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one?
The InChIKey is CYXIMPARGITFQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c1-9-2-5-14-12(6-9)16(15(19)20-14)8-10-7-11(17)3-4-13(10)18/h2-7,17-18H,8H2,1H3.
What are the key properties of 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one?
3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one has a molecular weight of 271.27 g/mol, XLogP of 2.36, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-dihydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one is sourced from PubChem (CID 54588508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).