About 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one
5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one (PubChem CID 54589177) has the molecular formula C22H19F3N4O
and a molecular weight of 412.42 g/mol. Its IUPAC name is 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one.
Molecular Properties
| Compound Name | 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one |
| PubChem CID | 54589177 |
| Molecular Formula | C22H19F3N4O |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one |
| SMILES | O=c1c2cc(CN3CCC(F)(F)CC3)c3ccccn3c-2nn1-c1ccccc1F |
| InChI | InChI=1S/C22H19F3N4O/c23-17-5-1-2-7-19(17)29-21(30)16-13-15(14-27-11-8-22(24,25)9-12-27)18-6-3-4-10-28(18)20(16)26-29/h1-7,10,13H,8-9,11-12,14H2 |
| InChIKey | SKYRZUJJIGDTOG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one?
The IUPAC name of 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one (CID 54589177) is 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one.
What is the SMILES notation for 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one?
The canonical SMILES for 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one is O=c1c2cc(CN3CCC(F)(F)CC3)c3ccccn3c-2nn1-c1ccccc1F.
What is the InChIKey of 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one?
The InChIKey is SKYRZUJJIGDTOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F3N4O/c23-17-5-1-2-7-19(17)29-21(30)16-13-15(14-27-11-8-22(24,25)9-12-27)18-6-3-4-10-28(18)20(16)26-29/h1-7,10,13H,8-9,11-12,14H2.
What are the key properties of 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one?
5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one has a molecular weight of 412.42 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-(2-fluorophenyl)pyrazolo[4,3-c]quinolizin-3-one is sourced from PubChem (CID 54589177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).