About 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine
3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine (PubChem CID 54589241) has the molecular formula C20H18N4
and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine |
| PubChem CID | 54589241 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine |
| SMILES | Cc1cc(C)cc(-c2cnc3c(-c4cnccc4C)ccnn23)c1 |
| InChI | InChI=1S/C20H18N4/c1-13-8-14(2)10-16(9-13)19-12-22-20-17(5-7-23-24(19)20)18-11-21-6-4-15(18)3/h4-12H,1-3H3 |
| InChIKey | ATOHBIFTAUBIMF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine?
The IUPAC name of 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine (CID 54589241) is 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine.
What is the SMILES notation for 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine?
The canonical SMILES for 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine is Cc1cc(C)cc(-c2cnc3c(-c4cnccc4C)ccnn23)c1.
What is the InChIKey of 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine?
The InChIKey is ATOHBIFTAUBIMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4/c1-13-8-14(2)10-16(9-13)19-12-22-20-17(5-7-23-24(19)20)18-11-21-6-4-15(18)3/h4-12H,1-3H3.
What are the key properties of 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine?
3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine has a molecular weight of 314.39 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylphenyl)-8-(4-methyl-3-pyridinyl)imidazo[1,2-b]pyridazine is sourced from PubChem (CID 54589241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).