C27H48O5 — CID 54589626
(2E)-2-[[(1S,2S,3S,3aR,4R,5R,7aR)-3,4,5-triethyl-2-(methoxymethoxy)-4-(methoxymethoxymethyl)-1,7-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-5-yl]methylidene]butan-1-ol (PubChem CID 54589626) has the molecular formula C27H48O5 and a molecular weight of 452.68 g/mol. Its IUPAC name is (2E)-2-[[(1S,2S,3S,3aR,4R,5R,7aR)-3,4,5-triethyl-2-(methoxymethoxy)-4-(methoxymethoxymethyl)-1,7-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-5-yl]methylidene]butan-1-ol.
| Compound Name | (2E)-2-[[(1S,2S,3S,3aR,4R,5R,7aR)-3,4,5-triethyl-2-(methoxymethoxy)-4-(methoxymethoxymethyl)-1,7-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-5-yl]methylidene]butan-1-ol |
|---|---|
| PubChem CID | 54589626 |
| Molecular Formula | C27H48O5 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | (2E)-2-[[(1S,2S,3S,3aR,4R,5R,7aR)-3,4,5-triethyl-2-(methoxymethoxy)-4-(methoxymethoxymethyl)-1,7-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-5-yl]methylidene]butan-1-ol |
| SMILES | CC/C(=C\[C@@]1(CC)C=C(C)[C@H]2[C@H](C)[C@H](OCOC)[C@@H](CC)[C@@H]2[C@@]1(CC)COCOC)CO |
| InChI | InChI=1S/C27H48O5/c1-9-21(15-28)14-26(11-3)13-19(5)23-20(6)25(32-18-30-8)22(10-2)24(23)27(26,12-4)16-31-17-29-7/h13-14,20,22-25,28H,9-12,15-18H2,1-8H3/b21-14+/t20-,22-,23-,24-,25-,26+,27+/m0/s1 |
| InChIKey | ADPDJOOICLAQKI-YOUQDDQNSA-N |
| XLogP | 5.59 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|