C15H22O4 — CID 54589695
2-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-5-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 54589695) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-5-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-5-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 54589695 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-5-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C([C@H](C)CC[C@@H](O)C(C)(C)O)=CC1=O |
| InChI | InChI=1S/C15H22O4/c1-9(5-6-14(18)15(3,4)19)11-8-12(16)10(2)7-13(11)17/h7-9,14,18-19H,5-6H2,1-4H3/t9-,14-/m1/s1 |
| InChIKey | LZEFTUMPIKBQII-YMTOWFKASA-N |
| XLogP | 1.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|