About (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one
(3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one (PubChem CID 54589744) has the molecular formula C24H36O3
and a molecular weight of 372.55 g/mol. Its IUPAC name is (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one.
Molecular Properties
| Compound Name | (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one |
| PubChem CID | 54589744 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one |
| SMILES | C=CCCCCC#CC#CCCCCCCCC[C@@H]1C[C@@H](COC)OC1=O |
| InChI | InChI=1S/C24H36O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20-23(21-26-2)27-24(22)25/h3,22-23H,1,4-7,12-21H2,2H3/t22-,23+/m1/s1 |
| InChIKey | RLHXTIORMGMTQI-PKTZIBPZSA-N |
| XLogP | 5.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one?
The IUPAC name of (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one (CID 54589744) is (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one.
What is the SMILES notation for (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one?
The canonical SMILES for (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one is C=CCCCCC#CC#CCCCCCCCC[C@@H]1C[C@@H](COC)OC1=O.
What is the InChIKey of (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one?
The InChIKey is RLHXTIORMGMTQI-PKTZIBPZSA-N. The full InChI is InChI=1S/C24H36O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20-23(21-26-2)27-24(22)25/h3,22-23H,1,4-7,12-21H2,2H3/t22-,23+/m1/s1.
What are the key properties of (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one?
(3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one has a molecular weight of 372.55 g/mol, XLogP of 5.44, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-5-(methoxymethyl)-3-octadec-17-en-9,11-diynyloxolan-2-one is sourced from PubChem (CID 54589744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).