C23H38O3 — CID 54589746
(3R,5S)-5-(hydroxymethyl)-3-octadec-17-en-9-ynyloxolan-2-one (PubChem CID 54589746) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (3R,5S)-5-(hydroxymethyl)-3-octadec-17-en-9-ynyloxolan-2-one.
| Compound Name | (3R,5S)-5-(hydroxymethyl)-3-octadec-17-en-9-ynyloxolan-2-one |
|---|---|
| PubChem CID | 54589746 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (3R,5S)-5-(hydroxymethyl)-3-octadec-17-en-9-ynyloxolan-2-one |
| SMILES | C=CCCCCCCC#CCCCCCCCC[C@@H]1C[C@@H](CO)OC1=O |
| InChI | InChI=1S/C23H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-22(20-24)26-23(21)25/h2,21-22,24H,1,3-8,11-20H2/t21-,22+/m1/s1 |
| InChIKey | IGIJVQKQLNOUGZ-YADHBBJMSA-N |
| XLogP | 5.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|