C21H34N4O4 — CID 54589811
(2R,3R,4R,5S)-1-[2-[1-(1-adamantylmethyl)triazol-4-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 54589811) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-[1-(1-adamantylmethyl)triazol-4-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[2-[1-(1-adamantylmethyl)triazol-4-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 54589811 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-[1-(1-adamantylmethyl)triazol-4-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCc1cn(CC23CC4CC(CC(C4)C2)C3)nn1 |
| InChI | InChI=1S/C21H34N4O4/c26-11-17-19(28)20(29)18(27)10-24(17)2-1-16-9-25(23-22-16)12-21-6-13-3-14(7-21)5-15(4-13)8-21/h9,13-15,17-20,26-29H,1-8,10-12H2/t13?,14?,15?,17-,18+,19-,20-,21?/m1/s1 |
| InChIKey | ZTZWHFUETQHGEU-AXDNBSMXSA-N |
| XLogP | -0.20 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |