C19H13Cl2N3O3 — CID 54589851
(5S)-1'-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 54589851) has the molecular formula C19H13Cl2N3O3 and a molecular weight of 402.24 g/mol. Its IUPAC name is (5S)-1'-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | (5S)-1'-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 54589851 |
| Molecular Formula | C19H13Cl2N3O3 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | (5S)-1'-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | O=C1NC(=O)[C@]2(N1)C(=O)N(C/C=C/c1ccc(Cl)c(Cl)c1)c1ccccc12 |
| InChI | InChI=1S/C19H13Cl2N3O3/c20-13-8-7-11(10-14(13)21)4-3-9-24-15-6-2-1-5-12(15)19(17(24)26)16(25)22-18(27)23-19/h1-8,10H,9H2,(H2,22,23,25,27)/b4-3+/t19-/m0/s1 |
| InChIKey | DHFXVPUHKMWKRT-RTLBZRNLSA-N |
| XLogP | 3.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|