C23H38N4O4 — CID 54589893
(2R,3R,4R,5S)-1-[4-[1-(1-adamantylmethyl)triazol-4-yl]butyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 54589893) has the molecular formula C23H38N4O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[4-[1-(1-adamantylmethyl)triazol-4-yl]butyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[4-[1-(1-adamantylmethyl)triazol-4-yl]butyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 54589893 |
| Molecular Formula | C23H38N4O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (2R,3R,4R,5S)-1-[4-[1-(1-adamantylmethyl)triazol-4-yl]butyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCc1cn(CC23CC4CC(CC(C4)C2)C3)nn1 |
| InChI | InChI=1S/C23H38N4O4/c28-13-19-21(30)22(31)20(29)12-26(19)4-2-1-3-18-11-27(25-24-18)14-23-8-15-5-16(9-23)7-17(6-15)10-23/h11,15-17,19-22,28-31H,1-10,12-14H2/t15?,16?,17?,19-,20+,21-,22-,23?/m1/s1 |
| InChIKey | OXAYEPHDICAEMB-BUGVNMIWSA-N |
| XLogP | 0.58 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|