C26H44N4O5 — CID 54589895
(2R,3R,4R,5S)-1-[6-[4-(1-adamantylmethoxymethyl)triazol-1-yl]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 54589895) has the molecular formula C26H44N4O5 and a molecular weight of 492.66 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[6-[4-(1-adamantylmethoxymethyl)triazol-1-yl]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[6-[4-(1-adamantylmethoxymethyl)triazol-1-yl]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 54589895 |
| Molecular Formula | C26H44N4O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | (2R,3R,4R,5S)-1-[6-[4-(1-adamantylmethoxymethyl)triazol-1-yl]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCCCn1cc(COCC23CC4CC(CC(C4)C2)C3)nn1 |
| InChI | InChI=1S/C26H44N4O5/c31-15-22-24(33)25(34)23(32)14-29(22)5-3-1-2-4-6-30-13-21(27-28-30)16-35-17-26-10-18-7-19(11-26)9-20(8-18)12-26/h13,18-20,22-25,31-34H,1-12,14-17H2/t18?,19?,20?,22-,23+,24-,25-,26?/m1/s1 |
| InChIKey | INKXCTWABKRDEQ-FOCPICBHSA-N |
| XLogP | 1.33 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|