C28H36N6O — CID 54589991
N-[2-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-8b-yl]methyl]triazol-1-yl]ethyl]-4-hexylbenzamide (PubChem CID 54589991) has the molecular formula C28H36N6O and a molecular weight of 472.64 g/mol. Its IUPAC name is N-[2-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-8b-yl]methyl]triazol-1-yl]ethyl]-4-hexylbenzamide.
| Compound Name | N-[2-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-8b-yl]methyl]triazol-1-yl]ethyl]-4-hexylbenzamide |
|---|---|
| PubChem CID | 54589991 |
| Molecular Formula | C28H36N6O |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | N-[2-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-8b-yl]methyl]triazol-1-yl]ethyl]-4-hexylbenzamide |
| SMILES | CCCCCCc1ccc(C(=O)NCCn2cc(C[C@@]34CCN[C@@H]3Nc3ccccc34)nn2)cc1 |
| InChI | InChI=1S/C28H36N6O/c1-2-3-4-5-8-21-11-13-22(14-12-21)26(35)29-17-18-34-20-23(32-33-34)19-28-15-16-30-27(28)31-25-10-7-6-9-24(25)28/h6-7,9-14,20,27,30-31H,2-5,8,15-19H2,1H3,(H,29,35)/t27-,28-/m1/s1 |
| InChIKey | JKCNIIHZOWONGN-VSGBNLITSA-N |
| XLogP | 4.06 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|