C14H16O5 — CID 54590132
(1R,6R,10R,11R)-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-9,13-dione (PubChem CID 54590132) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (1R,6R,10R,11R)-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-9,13-dione.
| Compound Name | (1R,6R,10R,11R)-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-9,13-dione |
|---|---|
| PubChem CID | 54590132 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (1R,6R,10R,11R)-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-9,13-dione |
| SMILES | C[C@@]12COC(=O)[C@]1(O)[C@H]1C[C@]3(CCC=C32)CC(=O)O1 |
| InChI | InChI=1S/C14H16O5/c1-12-7-18-11(16)14(12,17)9-5-13(6-10(15)19-9)4-2-3-8(12)13/h3,9,17H,2,4-7H2,1H3/t9-,12+,13-,14-/m1/s1 |
| InChIKey | HNOMDAMETOTMOF-GJQVQUKXSA-N |
| XLogP | 0.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|