C14H14O6 — CID 54590133
(1S,6R,10R,11R)-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione (PubChem CID 54590133) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is (1S,6R,10R,11R)-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione.
| Compound Name | (1S,6R,10R,11R)-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione |
|---|---|
| PubChem CID | 54590133 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (1S,6R,10R,11R)-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione |
| SMILES | C[C@@]12COC(=O)[C@]1(O)[C@H]1C[C@]3(CC(=O)C=C32)CC(=O)O1 |
| InChI | InChI=1S/C14H14O6/c1-12-6-19-11(17)14(12,18)9-4-13(5-10(16)20-9)3-7(15)2-8(12)13/h2,9,18H,3-6H2,1H3/t9-,12+,13-,14-/m1/s1 |
| InChIKey | PNONIOKCSNKJGK-GJQVQUKXSA-N |
| XLogP | -0.11 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |