C17H24O6 — CID 54590224
tert-butyl (3R,3aR,7aS)-7-methoxy-3,6,7a-trimethyl-2,5-dioxo-3a,4-dihydro-1-benzofuran-3-carboxylate (PubChem CID 54590224) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is tert-butyl (3R,3aR,7aS)-7-methoxy-3,6,7a-trimethyl-2,5-dioxo-3a,4-dihydro-1-benzofuran-3-carboxylate.
| Compound Name | tert-butyl (3R,3aR,7aS)-7-methoxy-3,6,7a-trimethyl-2,5-dioxo-3a,4-dihydro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 54590224 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | tert-butyl (3R,3aR,7aS)-7-methoxy-3,6,7a-trimethyl-2,5-dioxo-3a,4-dihydro-1-benzofuran-3-carboxylate |
| SMILES | COC1=C(C)C(=O)C[C@@H]2[C@](C)(C(=O)OC(C)(C)C)C(=O)O[C@]12C |
| InChI | InChI=1S/C17H24O6/c1-9-10(18)8-11-16(5,13(19)22-15(2,3)4)14(20)23-17(11,6)12(9)21-7/h11H,8H2,1-7H3/t11-,16-,17+/m1/s1 |
| InChIKey | YJMIJZFHGCZHFA-LQAWEQHXSA-N |
| XLogP | 2.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|