C58H88O10 — CID 5459024
(E)-6-(2,5-dimethoxy-3-methylphenyl)-1-[(1R,2R)-2-(4-hydroxy-4-methylpentanoyl)-1,2-dimethylcyclopentyl]-4-methylhex-4-en-2-one (PubChem CID 5459024) has the molecular formula C58H88O10 and a molecular weight of 945.33 g/mol. Its IUPAC name is (E)-6-(2,5-dimethoxy-3-methylphenyl)-1-[(1R,2R)-2-(4-hydroxy-4-methylpentanoyl)-1,2-dimethylcyclopentyl]-4-methylhex-4-en-2-one.
| Compound Name | (E)-6-(2,5-dimethoxy-3-methylphenyl)-1-[(1R,2R)-2-(4-hydroxy-4-methylpentanoyl)-1,2-dimethylcyclopentyl]-4-methylhex-4-en-2-one |
|---|---|
| PubChem CID | 5459024 |
| Molecular Formula | C58H88O10 |
| Molecular Weight | 945.33 g/mol |
| Exact Mass | 944.64 |
| IUPAC Name | (E)-6-(2,5-dimethoxy-3-methylphenyl)-1-[(1R,2R)-2-(4-hydroxy-4-methylpentanoyl)-1,2-dimethylcyclopentyl]-4-methylhex-4-en-2-one |
| SMILES | COc1cc(C)c(OC)c(C/C=C(\C)CC(=O)C[C@@]2(C)CCC[C@@]2(C)C(=O)CCC(C)(C)O)c1.COc1cc(C)c(OC)c(C/C=C(\C)CC(=O)C[C@@]2(C)CCC[C@@]2(C)C(=O)CCC(C)(C)O)c1 |
| InChI | InChI=1S/2C29H44O5/c2*1-20(10-11-22-18-24(33-7)17-21(2)26(22)34-8)16-23(30)19-28(5)13-9-14-29(28,6)25(31)12-15-27(3,4)32/h2*10,17-18,32H,9,11-16,19H2,1-8H3/b2*20-10+/t2*28-,29+/m11/s1 |
| InChIKey | CABVNFBOWTVCJH-MMIWPRPXSA-N |
| XLogP | 12.33 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.33 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|