C19H28O5 — CID 54590633
(E)-3-[(2R)-2-[(E,1S)-1-hydroxy-2,4-dimethyldec-2-enyl]-5-oxo-2H-furan-4-yl]prop-2-enoic acid (PubChem CID 54590633) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (E)-3-[(2R)-2-[(E,1S)-1-hydroxy-2,4-dimethyldec-2-enyl]-5-oxo-2H-furan-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(2R)-2-[(E,1S)-1-hydroxy-2,4-dimethyldec-2-enyl]-5-oxo-2H-furan-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54590633 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (E)-3-[(2R)-2-[(E,1S)-1-hydroxy-2,4-dimethyldec-2-enyl]-5-oxo-2H-furan-4-yl]prop-2-enoic acid |
| SMILES | CCCCCCC(C)/C=C(\C)[C@H](O)[C@H]1C=C(/C=C/C(=O)O)C(=O)O1 |
| InChI | InChI=1S/C19H28O5/c1-4-5-6-7-8-13(2)11-14(3)18(22)16-12-15(19(23)24-16)9-10-17(20)21/h9-13,16,18,22H,4-8H2,1-3H3,(H,20,21)/b10-9+,14-11+/t13?,16-,18+/m1/s1 |
| InChIKey | JIEAIWBXHHLQAC-PSUWYRBNSA-N |
| XLogP | 3.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|