C14H16FN5O — CID 54591005
3-[3-(tert-butylamino)-1,2,4-triazin-6-yl]-4-fluorobenzamide (PubChem CID 54591005) has the molecular formula C14H16FN5O and a molecular weight of 289.31 g/mol. Its IUPAC name is 3-[3-(tert-butylamino)-1,2,4-triazin-6-yl]-4-fluorobenzamide.
| Compound Name | 3-[3-(tert-butylamino)-1,2,4-triazin-6-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 54591005 |
| Molecular Formula | C14H16FN5O |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-[3-(tert-butylamino)-1,2,4-triazin-6-yl]-4-fluorobenzamide |
| SMILES | CC(C)(C)Nc1ncc(-c2cc(C(N)=O)ccc2F)nn1 |
| InChI | InChI=1S/C14H16FN5O/c1-14(2,3)18-13-17-7-11(19-20-13)9-6-8(12(16)21)4-5-10(9)15/h4-7H,1-3H3,(H2,16,21)(H,17,18,20) |
| InChIKey | GAEXQNIOOJEWGV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |