C23H24N4O3 — CID 54591335
4-ethyl-3-[2-(4-morpholin-4-ylphenyl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 54591335) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-ethyl-3-[2-(4-morpholin-4-ylphenyl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 4-ethyl-3-[2-(4-morpholin-4-ylphenyl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 54591335 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-ethyl-3-[2-(4-morpholin-4-ylphenyl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CCC1CC(=O)NN=C1c1ccc2nc(-c3ccc(N4CCOCC4)cc3)oc2c1 |
| InChI | InChI=1S/C23H24N4O3/c1-2-15-14-21(28)25-26-22(15)17-5-8-19-20(13-17)30-23(24-19)16-3-6-18(7-4-16)27-9-11-29-12-10-27/h3-8,13,15H,2,9-12,14H2,1H3,(H,25,28) |
| InChIKey | VUMHLSDGAKCABJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|