C26H35ClN6O2Si — CID 54591360
N'-(3,5-dimethoxyphenyl)-N'-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N-(trimethylsilylmethyl)ethane-1,2-diamine;hydrochloride (PubChem CID 54591360) has the molecular formula C26H35ClN6O2Si and a molecular weight of 527.15 g/mol. Its IUPAC name is N'-(3,5-dimethoxyphenyl)-N'-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N-(trimethylsilylmethyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(3,5-dimethoxyphenyl)-N'-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N-(trimethylsilylmethyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 54591360 |
| Molecular Formula | C26H35ClN6O2Si |
| Molecular Weight | 527.15 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | N'-(3,5-dimethoxyphenyl)-N'-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N-(trimethylsilylmethyl)ethane-1,2-diamine;hydrochloride |
| SMILES | COc1cc(OC)cc(N(CCNC[Si](C)(C)C)c2ccc3ncc(-c4cnn(C)c4)nc3c2)c1.Cl |
| InChI | InChI=1S/C26H34N6O2Si.ClH/c1-31-17-19(15-29-31)26-16-28-24-8-7-20(13-25(24)30-26)32(10-9-27-18-35(4,5)6)21-11-22(33-2)14-23(12-21)34-3;/h7-8,11-17,27H,9-10,18H2,1-6H3;1H |
| InChIKey | JMKXJKVYUUVONH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.15 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|