C29H37N5O4 — CID 54591369
6-[(2R)-4-(3-carbamoyl-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(5-hydroxy-2-adamantyl)pyridine-2-carboxamide (PubChem CID 54591369) has the molecular formula C29H37N5O4 and a molecular weight of 519.65 g/mol. Its IUPAC name is 6-[(2R)-4-(3-carbamoyl-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(5-hydroxy-2-adamantyl)pyridine-2-carboxamide.
| Compound Name | 6-[(2R)-4-(3-carbamoyl-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(5-hydroxy-2-adamantyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 54591369 |
| Molecular Formula | C29H37N5O4 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | 6-[(2R)-4-(3-carbamoyl-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(5-hydroxy-2-adamantyl)pyridine-2-carboxamide |
| SMILES | COc1ccc(N2CCN(c3cccc(C(=O)NC4C5CC6CC4CC(O)(C6)C5)n3)[C@H](C)C2)cc1C(N)=O |
| InChI | InChI=1S/C29H37N5O4/c1-17-16-33(21-6-7-24(38-2)22(12-21)27(30)35)8-9-34(17)25-5-3-4-23(31-25)28(36)32-26-19-10-18-11-20(26)15-29(37,13-18)14-19/h3-7,12,17-20,26,37H,8-11,13-16H2,1-2H3,(H2,30,35)(H,32,36)/t17-,18?,19?,20?,26?,29?/m1/s1 |
| InChIKey | WKFJNQLHISMGMV-QYJBHAJHSA-N |
| XLogP | 2.57 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|