C16H16F6N2O3S — CID 54591457
9-[2,5-bis(trifluoromethyl)phenyl]sulfonyl-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 54591457) has the molecular formula C16H16F6N2O3S and a molecular weight of 430.37 g/mol. Its IUPAC name is 9-[2,5-bis(trifluoromethyl)phenyl]sulfonyl-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | 9-[2,5-bis(trifluoromethyl)phenyl]sulfonyl-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 54591457 |
| Molecular Formula | C16H16F6N2O3S |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 9-[2,5-bis(trifluoromethyl)phenyl]sulfonyl-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1NCCC12CCCN(S(=O)(=O)c1cc(C(F)(F)F)ccc1C(F)(F)F)C2 |
| InChI | InChI=1S/C16H16F6N2O3S/c17-15(18,19)10-2-3-11(16(20,21)22)12(8-10)28(26,27)24-7-1-4-14(9-24)5-6-23-13(14)25/h2-3,8H,1,4-7,9H2,(H,23,25) |
| InChIKey | VXUJTDRWLIARLT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |