C17H18F6N2O3S — CID 54591621
8-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2,8-diazaspiro[5.5]undecan-1-one (PubChem CID 54591621) has the molecular formula C17H18F6N2O3S and a molecular weight of 444.40 g/mol. Its IUPAC name is 8-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2,8-diazaspiro[5.5]undecan-1-one.
| Compound Name | 8-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2,8-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 54591621 |
| Molecular Formula | C17H18F6N2O3S |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 8-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2,8-diazaspiro[5.5]undecan-1-one |
| SMILES | O=C1NCCCC12CCCN(S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C17H18F6N2O3S/c18-16(19,20)11-7-12(17(21,22)23)9-13(8-11)29(27,28)25-6-2-4-15(10-25)3-1-5-24-14(15)26/h7-9H,1-6,10H2,(H,24,26) |
| InChIKey | UBVSIDSGDMELLB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |