C16H20Cl3N3OS2 — CID 54591666
(E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(cyclohexylcarbamothioylamino)ethyl]prop-2-enamide (PubChem CID 54591666) has the molecular formula C16H20Cl3N3OS2 and a molecular weight of 440.85 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(cyclohexylcarbamothioylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(cyclohexylcarbamothioylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 54591666 |
| Molecular Formula | C16H20Cl3N3OS2 |
| Molecular Weight | 440.85 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(cyclohexylcarbamothioylamino)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)NC(NC(=S)NC1CCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H20Cl3N3OS2/c17-16(18,19)14(21-13(23)9-8-12-7-4-10-25-12)22-15(24)20-11-5-2-1-3-6-11/h4,7-11,14H,1-3,5-6H2,(H,21,23)(H2,20,22,24)/b9-8+ |
| InChIKey | RPBBMPFZBAANOO-CMDGGOBGSA-N |
| XLogP | 4.37 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|