C16H22Cl3N3O2S2 — CID 54591738
(E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(3-propan-2-yloxypropylcarbamothioylamino)ethyl]prop-2-enamide (PubChem CID 54591738) has the molecular formula C16H22Cl3N3O2S2 and a molecular weight of 458.86 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(3-propan-2-yloxypropylcarbamothioylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(3-propan-2-yloxypropylcarbamothioylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 54591738 |
| Molecular Formula | C16H22Cl3N3O2S2 |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(3-propan-2-yloxypropylcarbamothioylamino)ethyl]prop-2-enamide |
| SMILES | CC(C)OCCCNC(=S)NC(NC(=O)/C=C/c1cccs1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H22Cl3N3O2S2/c1-11(2)24-9-4-8-20-15(25)22-14(16(17,18)19)21-13(23)7-6-12-5-3-10-26-12/h3,5-7,10-11,14H,4,8-9H2,1-2H3,(H,21,23)(H2,20,22,25)/b7-6+ |
| InChIKey | YPLKEMOFAGQILT-VOTSOKGWSA-N |
| XLogP | 3.85 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|