C17H22Cl3N3OS2 — CID 54591740
(E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(cycloheptylcarbamothioylamino)ethyl]prop-2-enamide (PubChem CID 54591740) has the molecular formula C17H22Cl3N3OS2 and a molecular weight of 454.88 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(cycloheptylcarbamothioylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(cycloheptylcarbamothioylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 54591740 |
| Molecular Formula | C17H22Cl3N3OS2 |
| Molecular Weight | 454.88 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-(cycloheptylcarbamothioylamino)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)NC(NC(=S)NC1CCCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H22Cl3N3OS2/c18-17(19,20)15(22-14(24)10-9-13-8-5-11-26-13)23-16(25)21-12-6-3-1-2-4-7-12/h5,8-12,15H,1-4,6-7H2,(H,22,24)(H2,21,23,25)/b10-9+ |
| InChIKey | WFMULCCERWZOLK-MDZDMXLPSA-N |
| XLogP | 4.76 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.88 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|