C15H19Cl3N4OS2 — CID 54591742
(E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-[(4-methylpiperazine-1-carbothioyl)amino]ethyl]prop-2-enamide (PubChem CID 54591742) has the molecular formula C15H19Cl3N4OS2 and a molecular weight of 441.84 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-[(4-methylpiperazine-1-carbothioyl)amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-[(4-methylpiperazine-1-carbothioyl)amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 54591742 |
| Molecular Formula | C15H19Cl3N4OS2 |
| Molecular Weight | 441.84 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | (E)-3-thiophen-2-yl-N-[2,2,2-trichloro-1-[(4-methylpiperazine-1-carbothioyl)amino]ethyl]prop-2-enamide |
| SMILES | CN1CCN(C(=S)NC(NC(=O)/C=C/c2cccs2)C(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C15H19Cl3N4OS2/c1-21-6-8-22(9-7-21)14(24)20-13(15(16,17)18)19-12(23)5-4-11-3-2-10-25-11/h2-5,10,13H,6-9H2,1H3,(H,19,23)(H,20,24)/b5-4+ |
| InChIKey | WXVKAFJIZHYPCZ-SNAWJCMRSA-N |
| XLogP | 2.70 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.84 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|