About (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine
(NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine (PubChem CID 5459185) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine |
| PubChem CID | 5459185 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine |
| SMILES | CC(C)=CCC/C(C)=C/C=N\O |
| InChI | InChI=1S/C10H17NO/c1-9(2)5-4-6-10(3)7-8-11-12/h5,7-8,12H,4,6H2,1-3H3/b10-7+,11-8- |
| InChIKey | LXFKDMGMYAHNAQ-WAKDDQPJSA-N |
| XLogP | 3.14 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine (CID 5459185) is (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine is CC(C)=CCC/C(C)=C/C=N\O.
What is the InChIKey of (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine?
The InChIKey is LXFKDMGMYAHNAQ-WAKDDQPJSA-N. The full InChI is InChI=1S/C10H17NO/c1-9(2)5-4-6-10(3)7-8-11-12/h5,7-8,12H,4,6H2,1-3H3/b10-7+,11-8-.
What are the key properties of (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine?
(NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine has a molecular weight of 167.25 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[(2E)-3,7-dimethylocta-2,6-dienylidene]hydroxylamine is sourced from PubChem (CID 5459185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).