About (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide
(E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide (PubChem CID 54592043) has the molecular formula C24H19ClN2O2S
and a molecular weight of 434.95 g/mol. Its IUPAC name is (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide |
| PubChem CID | 54592043 |
| Molecular Formula | C24H19ClN2O2S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1ccc(Cl)cc1)c1ccc(OCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C24H19ClN2O2S/c1-27(24(28)15-8-17-6-9-18(25)10-7-17)19-11-13-20(14-12-19)29-16-23-26-21-4-2-3-5-22(21)30-23/h2-15H,16H2,1H3/b15-8+ |
| InChIKey | JARDUQDBHBMLPH-OVCLIPMQSA-N |
| XLogP | 6.20 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide?
The IUPAC name of (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide (CID 54592043) is (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide.
What is the SMILES notation for (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide?
The canonical SMILES for (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide is CN(C(=O)/C=C/c1ccc(Cl)cc1)c1ccc(OCc2nc3ccccc3s2)cc1.
What is the InChIKey of (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide?
The InChIKey is JARDUQDBHBMLPH-OVCLIPMQSA-N. The full InChI is InChI=1S/C24H19ClN2O2S/c1-27(24(28)15-8-17-6-9-18(25)10-7-17)19-11-13-20(14-12-19)29-16-23-26-21-4-2-3-5-22(21)30-23/h2-15H,16H2,1H3/b15-8+.
What are the key properties of (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide?
(E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide has a molecular weight of 434.95 g/mol, XLogP of 6.20, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide is sourced from PubChem (CID 54592043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).