C23H24F4N4O2 — CID 54592150
3-[4-(1-amino-2-phenylethyl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one (PubChem CID 54592150) has the molecular formula C23H24F4N4O2 and a molecular weight of 464.46 g/mol. Its IUPAC name is 3-[4-(1-amino-2-phenylethyl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one.
| Compound Name | 3-[4-(1-amino-2-phenylethyl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
|---|---|
| PubChem CID | 54592150 |
| Molecular Formula | C23H24F4N4O2 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 3-[4-(1-amino-2-phenylethyl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
| SMILES | CCCCC(C(=O)COc1c(F)c(F)cc(F)c1F)n1cc(C(N)Cc2ccccc2)nn1 |
| InChI | InChI=1S/C23H24F4N4O2/c1-2-3-9-19(20(32)13-33-23-21(26)15(24)11-16(25)22(23)27)31-12-18(29-30-31)17(28)10-14-7-5-4-6-8-14/h4-8,11-12,17,19H,2-3,9-10,13,28H2,1H3 |
| InChIKey | KYTVWAYPPPKGDG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|