C20H26F4N4O2 — CID 54592152
3-[4-(3-aminopentan-3-yl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one (PubChem CID 54592152) has the molecular formula C20H26F4N4O2 and a molecular weight of 430.45 g/mol. Its IUPAC name is 3-[4-(3-aminopentan-3-yl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one.
| Compound Name | 3-[4-(3-aminopentan-3-yl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
|---|---|
| PubChem CID | 54592152 |
| Molecular Formula | C20H26F4N4O2 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-[4-(3-aminopentan-3-yl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
| SMILES | CCCCC(C(=O)COc1c(F)c(F)cc(F)c1F)n1cc(C(N)(CC)CC)nn1 |
| InChI | InChI=1S/C20H26F4N4O2/c1-4-7-8-14(28-10-16(26-27-28)20(25,5-2)6-3)15(29)11-30-19-17(23)12(21)9-13(22)18(19)24/h9-10,14H,4-8,11,25H2,1-3H3 |
| InChIKey | FOOAQIMYNYAEJU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|