C22H28F4N4O2 — CID 54592155
3-[4-(1-amino-1-cyclopentylethyl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one (PubChem CID 54592155) has the molecular formula C22H28F4N4O2 and a molecular weight of 456.48 g/mol. Its IUPAC name is 3-[4-(1-amino-1-cyclopentylethyl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one.
| Compound Name | 3-[4-(1-amino-1-cyclopentylethyl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
|---|---|
| PubChem CID | 54592155 |
| Molecular Formula | C22H28F4N4O2 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 3-[4-(1-amino-1-cyclopentylethyl)triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
| SMILES | CCCCC(C(=O)COc1c(F)c(F)cc(F)c1F)n1cc(C(C)(N)C2CCCC2)nn1 |
| InChI | InChI=1S/C22H28F4N4O2/c1-3-4-9-16(17(31)12-32-21-19(25)14(23)10-15(24)20(21)26)30-11-18(28-29-30)22(2,27)13-7-5-6-8-13/h10-11,13,16H,3-9,12,27H2,1-2H3 |
| InChIKey | LYXQKLVAGXENOG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|