C23H32F4N4O2 — CID 54592159
3-[4-[4-(methylamino)heptan-4-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one (PubChem CID 54592159) has the molecular formula C23H32F4N4O2 and a molecular weight of 472.53 g/mol. Its IUPAC name is 3-[4-[4-(methylamino)heptan-4-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one.
| Compound Name | 3-[4-[4-(methylamino)heptan-4-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
|---|---|
| PubChem CID | 54592159 |
| Molecular Formula | C23H32F4N4O2 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 3-[4-[4-(methylamino)heptan-4-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
| SMILES | CCCCC(C(=O)COc1c(F)c(F)cc(F)c1F)n1cc(C(CCC)(CCC)NC)nn1 |
| InChI | InChI=1S/C23H32F4N4O2/c1-5-8-9-17(18(32)14-33-22-20(26)15(24)12-16(25)21(22)27)31-13-19(29-30-31)23(28-4,10-6-2)11-7-3/h12-13,17,28H,5-11,14H2,1-4H3 |
| InChIKey | BQEBYKSKGYLLLY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|