C45H68O7S — CID 5459222
[(1R)-1-[(2S,5S)-5-[(2S,5S)-5-[(E,1S)-1-hydroxy-13-[(3R,5S)-5-methyl-2-oxo-3-phenylsulfanyloxolan-3-yl]tridec-5-en-3-ynyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate (PubChem CID 5459222) has the molecular formula C45H68O7S and a molecular weight of 753.10 g/mol. Its IUPAC name is [(1R)-1-[(2S,5S)-5-[(2S,5S)-5-[(E,1S)-1-hydroxy-13-[(3R,5S)-5-methyl-2-oxo-3-phenylsulfanyloxolan-3-yl]tridec-5-en-3-ynyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate.
| Compound Name | [(1R)-1-[(2S,5S)-5-[(2S,5S)-5-[(E,1S)-1-hydroxy-13-[(3R,5S)-5-methyl-2-oxo-3-phenylsulfanyloxolan-3-yl]tridec-5-en-3-ynyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate |
|---|---|
| PubChem CID | 5459222 |
| Molecular Formula | C45H68O7S |
| Molecular Weight | 753.10 g/mol |
| Exact Mass | 752.47 |
| IUPAC Name | [(1R)-1-[(2S,5S)-5-[(2S,5S)-5-[(E,1S)-1-hydroxy-13-[(3R,5S)-5-methyl-2-oxo-3-phenylsulfanyloxolan-3-yl]tridec-5-en-3-ynyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate |
| SMILES | CCCCCCCCCC[C@@H](OC(C)=O)[C@@H]1CC[C@@H]([C@@H]2CC[C@@H]([C@@H](O)CC#C/C=C/CCCCCCC[C@@]3(Sc4ccccc4)C[C@H](C)OC3=O)O2)O1 |
| InChI | InChI=1S/C45H68O7S/c1-4-5-6-7-8-14-17-23-28-40(50-36(3)46)41-31-32-43(52-41)42-30-29-39(51-42)38(47)27-22-16-13-11-9-10-12-15-18-24-33-45(34-35(2)49-44(45)48)53-37-25-20-19-21-26-37/h11,13,19-21,25-26,35,38-43,47H,4-10,12,14-15,17-18,23-24,27-34H2,1-3H3/b13-11+/t35-,38-,39-,40+,41-,42-,43-,45+/m0/s1 |
| InChIKey | NUXTYTNPFRWHKL-HDGUODTPSA-N |
| XLogP | 10.45 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.10 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|