C15H17F3N2O5 — CID 54592302
(4R)-N-hydroxy-2-[4-methoxy-3-propyl-5-(trifluoromethoxy)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 54592302) has the molecular formula C15H17F3N2O5 and a molecular weight of 362.30 g/mol. Its IUPAC name is (4R)-N-hydroxy-2-[4-methoxy-3-propyl-5-(trifluoromethoxy)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-N-hydroxy-2-[4-methoxy-3-propyl-5-(trifluoromethoxy)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 54592302 |
| Molecular Formula | C15H17F3N2O5 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (4R)-N-hydroxy-2-[4-methoxy-3-propyl-5-(trifluoromethoxy)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | CCCc1cc(C2=N[C@@H](C(=O)NO)CO2)cc(OC(F)(F)F)c1OC |
| InChI | InChI=1S/C15H17F3N2O5/c1-3-4-8-5-9(14-19-10(7-24-14)13(21)20-22)6-11(12(8)23-2)25-15(16,17)18/h5-6,10,22H,3-4,7H2,1-2H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | NSPXSMWKFKIIBA-SNVBAGLBSA-N |
| XLogP | 2.20 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|