C12H11F3N2O5 — CID 54592306
(4S)-N-hydroxy-2-[4-methoxy-3-(trifluoromethoxy)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 54592306) has the molecular formula C12H11F3N2O5 and a molecular weight of 320.22 g/mol. Its IUPAC name is (4S)-N-hydroxy-2-[4-methoxy-3-(trifluoromethoxy)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide.
| Compound Name | (4S)-N-hydroxy-2-[4-methoxy-3-(trifluoromethoxy)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 54592306 |
| Molecular Formula | C12H11F3N2O5 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (4S)-N-hydroxy-2-[4-methoxy-3-(trifluoromethoxy)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(C2=N[C@H](C(=O)NO)CO2)cc1OC(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O5/c1-20-8-3-2-6(4-9(8)22-12(13,14)15)11-16-7(5-21-11)10(18)17-19/h2-4,7,19H,5H2,1H3,(H,17,18)/t7-/m0/s1 |
| InChIKey | QHYOWOKCMNPPEQ-ZETCQYMHSA-N |
| XLogP | 1.24 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|