About 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride
2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride (PubChem CID 54592550) has the molecular formula C12H18Cl4N2O2
and a molecular weight of 364.10 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride |
| PubChem CID | 54592550 |
| Molecular Formula | C12H18Cl4N2O2 |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride |
| SMILES | CN(C)CCNC(C(=O)O)c1ccc(Cl)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C12H16Cl2N2O2.2ClH/c1-16(2)6-5-15-11(12(17)18)8-3-4-9(13)10(14)7-8;;/h3-4,7,11,15H,5-6H2,1-2H3,(H,17,18);2*1H |
| InChIKey | DYRBIDSSSWMILA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride?
The IUPAC name of 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride (CID 54592550) is 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride?
The canonical SMILES for 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride is CN(C)CCNC(C(=O)O)c1ccc(Cl)c(Cl)c1.Cl.Cl.
What is the InChIKey of 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride?
The InChIKey is DYRBIDSSSWMILA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Cl2N2O2.2ClH/c1-16(2)6-5-15-11(12(17)18)8-3-4-9(13)10(14)7-8;;/h3-4,7,11,15H,5-6H2,1-2H3,(H,17,18);2*1H.
What are the key properties of 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride?
2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride has a molecular weight of 364.10 g/mol, XLogP of 3.11, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetic acid;dihydrochloride is sourced from PubChem (CID 54592550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).