About methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride
methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride (PubChem CID 54592551) has the molecular formula C13H20Cl4N2O2
and a molecular weight of 378.13 g/mol. Its IUPAC name is methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride.
Molecular Properties
| Compound Name | methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride |
| PubChem CID | 54592551 |
| Molecular Formula | C13H20Cl4N2O2 |
| Molecular Weight | 378.13 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride |
| SMILES | COC(=O)C(NCCN(C)C)c1ccc(Cl)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C13H18Cl2N2O2.2ClH/c1-17(2)7-6-16-12(13(18)19-3)9-4-5-10(14)11(15)8-9;;/h4-5,8,12,16H,6-7H2,1-3H3;2*1H |
| InChIKey | KMDIRTKKHFWRPD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride?
The IUPAC name of methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride (CID 54592551) is methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride.
What is the SMILES notation for methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride?
The canonical SMILES for methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride is COC(=O)C(NCCN(C)C)c1ccc(Cl)c(Cl)c1.Cl.Cl.
What is the InChIKey of methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride?
The InChIKey is KMDIRTKKHFWRPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl2N2O2.2ClH/c1-17(2)7-6-16-12(13(18)19-3)9-4-5-10(14)11(15)8-9;;/h4-5,8,12,16H,6-7H2,1-3H3;2*1H.
What are the key properties of methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride?
methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride has a molecular weight of 378.13 g/mol, XLogP of 3.20, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetate;dihydrochloride is sourced from PubChem (CID 54592551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).