About 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine
1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine (PubChem CID 54592592) has the molecular formula C10H19N5
and a molecular weight of 209.30 g/mol. Its IUPAC name is 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine.
Molecular Properties
| Compound Name | 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine |
| PubChem CID | 54592592 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine |
| SMILES | CCc1nnc(CN2CCNCC2)n1C |
| InChI | InChI=1S/C10H19N5/c1-3-9-12-13-10(14(9)2)8-15-6-4-11-5-7-15/h11H,3-8H2,1-2H3 |
| InChIKey | OSYUNOXLMUDBNA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine?
The IUPAC name of 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine (CID 54592592) is 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine.
What is the SMILES notation for 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine?
The canonical SMILES for 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine is CCc1nnc(CN2CCNCC2)n1C.
What is the InChIKey of 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine?
The InChIKey is OSYUNOXLMUDBNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5/c1-3-9-12-13-10(14(9)2)8-15-6-4-11-5-7-15/h11H,3-8H2,1-2H3.
What are the key properties of 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine?
1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine has a molecular weight of 209.30 g/mol, XLogP of -0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-ethyl-4-methyl-1,2,4-triazol-3-yl)methyl]piperazine is sourced from PubChem (CID 54592592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).