About 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine
2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine (PubChem CID 54592632) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine.
Analyze 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine?
The IUPAC name of 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine (CID 54592632) is 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine.
What is the SMILES notation for 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine?
The canonical SMILES for 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine is Cc1nc(C)n(CC2CCCCN2)n1.
What is the InChIKey of 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine?
The InChIKey is INDKHEXXHYDJLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-8-12-9(2)14(13-8)7-10-5-3-4-6-11-10/h10-11H,3-7H2,1-2H3.
What are the key properties of 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine?
2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine has a molecular weight of 194.28 g/mol, XLogP of 1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidine is sourced from PubChem (CID 54592632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).