About 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine
2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine (PubChem CID 54592635) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine.
Molecular Properties
| Compound Name | 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine |
| PubChem CID | 54592635 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine |
| SMILES | Cc1cc(C)n(CC2CNCCO2)n1 |
| InChI | InChI=1S/C10H17N3O/c1-8-5-9(2)13(12-8)7-10-6-11-3-4-14-10/h5,10-11H,3-4,6-7H2,1-2H3 |
| InChIKey | OGQYGLMJTYQJDL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine?
The IUPAC name of 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine (CID 54592635) is 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine.
What is the SMILES notation for 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine?
The canonical SMILES for 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine is Cc1cc(C)n(CC2CNCCO2)n1.
What is the InChIKey of 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine?
The InChIKey is OGQYGLMJTYQJDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-8-5-9(2)13(12-8)7-10-6-11-3-4-14-10/h5,10-11H,3-4,6-7H2,1-2H3.
What are the key properties of 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine?
2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine has a molecular weight of 195.27 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholine is sourced from PubChem (CID 54592635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).