C9H13N3 — CID 54592647
2-ethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine (PubChem CID 54592647) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-ethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine.
| Compound Name | 2-ethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 54592647 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-ethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
| SMILES | CCc1ncc2c(n1)CNCC2 |
| InChI | InChI=1S/C9H13N3/c1-2-9-11-5-7-3-4-10-6-8(7)12-9/h5,10H,2-4,6H2,1H3 |
| InChIKey | RQQFQIHYFJXNMK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |