About 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide
3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide (PubChem CID 54592691) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide |
| PubChem CID | 54592691 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)C(C)CN |
| InChI | InChI=1S/C9H16N4O/c1-5(4-10)9(14)11-8-6(2)12-13-7(8)3/h5H,4,10H2,1-3H3,(H,11,14)(H,12,13) |
| InChIKey | RMSZKQRQTBREEZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide?
The IUPAC name of 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide (CID 54592691) is 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide.
What is the SMILES notation for 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide?
The canonical SMILES for 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide is Cc1n[nH]c(C)c1NC(=O)C(C)CN.
What is the InChIKey of 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide?
The InChIKey is RMSZKQRQTBREEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-5(4-10)9(14)11-8-6(2)12-13-7(8)3/h5H,4,10H2,1-3H3,(H,11,14)(H,12,13).
What are the key properties of 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide?
3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide has a molecular weight of 196.25 g/mol, XLogP of 0.56, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanamide is sourced from PubChem (CID 54592691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).