About 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride
2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride (PubChem CID 54592697) has the molecular formula C6H9ClN2O2S
and a molecular weight of 208.67 g/mol. Its IUPAC name is 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride |
| PubChem CID | 54592697 |
| Molecular Formula | C6H9ClN2O2S |
| Molecular Weight | 208.67 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride |
| SMILES | Cl.O=C(O)CSCc1ncc[nH]1 |
| InChI | InChI=1S/C6H8N2O2S.ClH/c9-6(10)4-11-3-5-7-1-2-8-5;/h1-2H,3-4H2,(H,7,8)(H,9,10);1H |
| InChIKey | VZQGBHMDZKIFCG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.67 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride?
The IUPAC name of 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride (CID 54592697) is 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride.
What is the SMILES notation for 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride?
The canonical SMILES for 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride is Cl.O=C(O)CSCc1ncc[nH]1.
What is the InChIKey of 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride?
The InChIKey is VZQGBHMDZKIFCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S.ClH/c9-6(10)4-11-3-5-7-1-2-8-5;/h1-2H,3-4H2,(H,7,8)(H,9,10);1H.
What are the key properties of 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride?
2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride has a molecular weight of 208.67 g/mol, XLogP of 1.15, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-2-ylmethylsulfanyl)acetic acid;hydrochloride is sourced from PubChem (CID 54592697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).