About 3-methylbutane-1,2-diamine;dihydrochloride
3-methylbutane-1,2-diamine;dihydrochloride (PubChem CID 54592856) has the molecular formula C5H16Cl2N2
and a molecular weight of 175.10 g/mol. Its IUPAC name is 3-methylbutane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 3-methylbutane-1,2-diamine;dihydrochloride |
| PubChem CID | 54592856 |
| Molecular Formula | C5H16Cl2N2 |
| Molecular Weight | 175.10 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 3-methylbutane-1,2-diamine;dihydrochloride |
| SMILES | CC(C)C(N)CN.Cl.Cl |
| InChI | InChI=1S/C5H14N2.2ClH/c1-4(2)5(7)3-6;;/h4-5H,3,6-7H2,1-2H3;2*1H |
| InChIKey | DYPOEEJDEYWPAI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.10 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutane-1,2-diamine;dihydrochloride?
The IUPAC name of 3-methylbutane-1,2-diamine;dihydrochloride (CID 54592856) is 3-methylbutane-1,2-diamine;dihydrochloride.
What is the SMILES notation for 3-methylbutane-1,2-diamine;dihydrochloride?
The canonical SMILES for 3-methylbutane-1,2-diamine;dihydrochloride is CC(C)C(N)CN.Cl.Cl.
What is the InChIKey of 3-methylbutane-1,2-diamine;dihydrochloride?
The InChIKey is DYPOEEJDEYWPAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2.2ClH/c1-4(2)5(7)3-6;;/h4-5H,3,6-7H2,1-2H3;2*1H.
What are the key properties of 3-methylbutane-1,2-diamine;dihydrochloride?
3-methylbutane-1,2-diamine;dihydrochloride has a molecular weight of 175.10 g/mol, XLogP of 0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 54592856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).